C22H16F3N5O7S — CID 67590838
(2S)-2-(1,3-benzodioxol-4-yl)-2-[[5-[(8-hydroxyquinolin-7-yl)amino]-1,3,4-thiadiazol-2-yl]amino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 67590838) has the molecular formula C22H16F3N5O7S and a molecular weight of 551.46 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-4-yl)-2-[[5-[(8-hydroxyquinolin-7-yl)amino]-1,3,4-thiadiazol-2-yl]amino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-(1,3-benzodioxol-4-yl)-2-[[5-[(8-hydroxyquinolin-7-yl)amino]-1,3,4-thiadiazol-2-yl]amino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67590838 |
| Molecular Formula | C22H16F3N5O7S |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-4-yl)-2-[[5-[(8-hydroxyquinolin-7-yl)amino]-1,3,4-thiadiazol-2-yl]amino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)[C@@H](Nc1nnc(Nc2ccc3cccnc3c2O)s1)c1cccc2c1OCO2 |
| InChI | InChI=1S/C20H15N5O5S.C2HF3O2/c26-16-12(7-6-10-3-2-8-21-14(10)16)22-19-24-25-20(31-19)23-15(18(27)28)11-4-1-5-13-17(11)30-9-29-13;3-2(4,5)1(6)7/h1-8,15,26H,9H2,(H,22,24)(H,23,25)(H,27,28);(H,6,7)/t15-;/m0./s1 |
| InChIKey | YXFGATPGMCXMFM-RSAXXLAASA-N |
| XLogP | 4.14 |
| TPSA | 176.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|