C19H16N2O4 — CID 67592172
1-(3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl)-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 67592172) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-(3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl)-9H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-(3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl)-9H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 67592172 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-(3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl)-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)c1cc2c([nH]c3ccccc32)c(C2C=CC3OCOC3C2)n1 |
| InChI | InChI=1S/C19H16N2O4/c22-19(23)14-8-12-11-3-1-2-4-13(11)20-18(12)17(21-14)10-5-6-15-16(7-10)25-9-24-15/h1-6,8,10,15-16,20H,7,9H2,(H,22,23) |
| InChIKey | VJTACYGLEDBHCL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|