C10H13NO — CID 67592264
1-(1,2,3,5-tetrahydroindolizin-8-yl)ethanone (PubChem CID 67592264) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-(1,2,3,5-tetrahydroindolizin-8-yl)ethanone.
| Compound Name | 1-(1,2,3,5-tetrahydroindolizin-8-yl)ethanone |
|---|---|
| PubChem CID | 67592264 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-(1,2,3,5-tetrahydroindolizin-8-yl)ethanone |
| SMILES | CC(=O)C1=C2CCCN2CC=C1 |
| InChI | InChI=1S/C10H13NO/c1-8(12)9-4-2-6-11-7-3-5-10(9)11/h2,4H,3,5-7H2,1H3 |
| InChIKey | MCLFYNBIZWBBML-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |