C12H9N3O4 — CID 67592363
1'-aminospiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone (PubChem CID 67592363) has the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. Its IUPAC name is 1'-aminospiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone.
| Compound Name | 1'-aminospiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone |
|---|---|
| PubChem CID | 67592363 |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1'-aminospiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone |
| SMILES | NN1C(=O)CC2(C(=O)NC(=O)c3ccccc32)C1=O |
| InChI | InChI=1S/C12H9N3O4/c13-15-8(16)5-12(11(15)19)7-4-2-1-3-6(7)9(17)14-10(12)18/h1-4H,5,13H2,(H,14,17,18) |
| InChIKey | PDRRTPYKUUHAJU-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|