About 1,1'-biphenyl;phosphoric acid;piperazine
1,1'-biphenyl;phosphoric acid;piperazine (PubChem CID 67592492) has the molecular formula C16H23N2O4P
and a molecular weight of 338.34 g/mol. Its IUPAC name is 1,1'-biphenyl;phosphoric acid;piperazine.
Molecular Properties
| Compound Name | 1,1'-biphenyl;phosphoric acid;piperazine |
| PubChem CID | 67592492 |
| Molecular Formula | C16H23N2O4P |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1,1'-biphenyl;phosphoric acid;piperazine |
| SMILES | C1CNCCN1.O=P(O)(O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H10N2.H3O4P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-4-3-5-1;1-5(2,3)4/h1-10H;5-6H,1-4H2;(H3,1,2,3,4) |
| InChIKey | CQFSLQZVZVANSY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;phosphoric acid;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;phosphoric acid;piperazine?
The IUPAC name of 1,1'-biphenyl;phosphoric acid;piperazine (CID 67592492) is 1,1'-biphenyl;phosphoric acid;piperazine.
What is the SMILES notation for 1,1'-biphenyl;phosphoric acid;piperazine?
The canonical SMILES for 1,1'-biphenyl;phosphoric acid;piperazine is C1CNCCN1.O=P(O)(O)O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;phosphoric acid;piperazine?
The InChIKey is CQFSLQZVZVANSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C4H10N2.H3O4P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-4-3-5-1;1-5(2,3)4/h1-10H;5-6H,1-4H2;(H3,1,2,3,4).
What are the key properties of 1,1'-biphenyl;phosphoric acid;piperazine?
1,1'-biphenyl;phosphoric acid;piperazine has a molecular weight of 338.34 g/mol, XLogP of 1.60, 1 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;phosphoric acid;piperazine is sourced from PubChem (CID 67592492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).