About 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine
3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine (PubChem CID 67592508) has the molecular formula C5H8F2N2
and a molecular weight of 134.13 g/mol. Its IUPAC name is 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine.
Molecular Properties
| Compound Name | 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine |
| PubChem CID | 67592508 |
| Molecular Formula | C5H8F2N2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine |
| SMILES | NC1=NCC(F)(F)CC1 |
| InChI | InChI=1S/C5H8F2N2/c6-5(7)2-1-4(8)9-3-5/h1-3H2,(H2,8,9) |
| InChIKey | CTXWKVCWAVYYFV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine?
The IUPAC name of 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine (CID 67592508) is 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine.
What is the SMILES notation for 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine?
The canonical SMILES for 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine is NC1=NCC(F)(F)CC1.
What is the InChIKey of 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine?
The InChIKey is CTXWKVCWAVYYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2N2/c6-5(7)2-1-4(8)9-3-5/h1-3H2,(H2,8,9).
What are the key properties of 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine?
3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine has a molecular weight of 134.13 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-4,5-dihydro-2H-pyridin-6-amine is sourced from PubChem (CID 67592508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).