C32H28N4 — CID 67592689
2-(2,4,6-triethylphenyl)porphyrin (PubChem CID 67592689) has the molecular formula C32H28N4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-(2,4,6-triethylphenyl)porphyrin.
| Compound Name | 2-(2,4,6-triethylphenyl)porphyrin |
|---|---|
| PubChem CID | 67592689 |
| Molecular Formula | C32H28N4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2-(2,4,6-triethylphenyl)porphyrin |
| SMILES | CCc1cc(CC)c(C2=CC3=N/C2=C\C2=N/C(=C\C4=N/C(=C\C5=N/C(=C\3)C=C5)C=C4)C=C2)c(CC)c1 |
| InChI | InChI=1S/C32H28N4/c1-4-20-13-21(5-2)32(22(6-3)14-20)30-18-29-17-27-10-9-25(34-27)15-23-7-8-24(33-23)16-26-11-12-28(35-26)19-31(30)36-29/h7-19H,4-6H2,1-3H3/b23-15-,24-16-,25-15-,26-16-,27-17-,28-19-,29-17-,31-19- |
| InChIKey | KLORXOJPZYILHR-RJXGYOSSSA-N |
| XLogP | 6.79 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |