About 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride
2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride (PubChem CID 67593062) has the molecular formula C6H14ClN3
and a molecular weight of 163.65 g/mol. Its IUPAC name is 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride.
Molecular Properties
| Compound Name | 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride |
| PubChem CID | 67593062 |
| Molecular Formula | C6H14ClN3 |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride |
| SMILES | CC1CN(C)CC(N)=N1.Cl |
| InChI | InChI=1S/C6H13N3.ClH/c1-5-3-9(2)4-6(7)8-5;/h5H,3-4H2,1-2H3,(H2,7,8);1H |
| InChIKey | SRSBVVHZDFGJGE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride?
The IUPAC name of 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride (CID 67593062) is 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride.
What is the SMILES notation for 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride?
The canonical SMILES for 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride is CC1CN(C)CC(N)=N1.Cl.
What is the InChIKey of 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride?
The InChIKey is SRSBVVHZDFGJGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3.ClH/c1-5-3-9(2)4-6(7)8-5;/h5H,3-4H2,1-2H3,(H2,7,8);1H.
What are the key properties of 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride?
2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride has a molecular weight of 163.65 g/mol, XLogP of 0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3,5-dihydro-2H-pyrazin-6-amine;hydrochloride is sourced from PubChem (CID 67593062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).