About 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride
1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride (PubChem CID 67593083) has the molecular formula C7H10ClF3N2
and a molecular weight of 214.62 g/mol. Its IUPAC name is 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride |
| PubChem CID | 67593083 |
| Molecular Formula | C7H10ClF3N2 |
| Molecular Weight | 214.62 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride |
| SMILES | CC(F)C(F)(F)N1C=CC=NC1.Cl |
| InChI | InChI=1S/C7H9F3N2.ClH/c1-6(8)7(9,10)12-4-2-3-11-5-12;/h2-4,6H,5H2,1H3;1H |
| InChIKey | VQCNDNXZTYCETF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride?
The IUPAC name of 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride (CID 67593083) is 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride.
What is the SMILES notation for 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride?
The canonical SMILES for 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride is CC(F)C(F)(F)N1C=CC=NC1.Cl.
What is the InChIKey of 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride?
The InChIKey is VQCNDNXZTYCETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2.ClH/c1-6(8)7(9,10)12-4-2-3-11-5-12;/h2-4,6H,5H2,1H3;1H.
What are the key properties of 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride?
1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride has a molecular weight of 214.62 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1,2-trifluoropropyl)-2H-pyrimidine;hydrochloride is sourced from PubChem (CID 67593083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).