About (1,2-dimethylcyclohexyl) benzoate
(1,2-dimethylcyclohexyl) benzoate (PubChem CID 67593313) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is (1,2-dimethylcyclohexyl) benzoate.
Molecular Properties
| Compound Name | (1,2-dimethylcyclohexyl) benzoate |
| PubChem CID | 67593313 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1,2-dimethylcyclohexyl) benzoate |
| SMILES | CC1CCCCC1(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O2/c1-12-8-6-7-11-15(12,2)17-14(16)13-9-4-3-5-10-13/h3-5,9-10,12H,6-8,11H2,1-2H3 |
| InChIKey | FEJZPASXZJLJCA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,2-dimethylcyclohexyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethylcyclohexyl) benzoate?
The IUPAC name of (1,2-dimethylcyclohexyl) benzoate (CID 67593313) is (1,2-dimethylcyclohexyl) benzoate.
What is the SMILES notation for (1,2-dimethylcyclohexyl) benzoate?
The canonical SMILES for (1,2-dimethylcyclohexyl) benzoate is CC1CCCCC1(C)OC(=O)c1ccccc1.
What is the InChIKey of (1,2-dimethylcyclohexyl) benzoate?
The InChIKey is FEJZPASXZJLJCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c1-12-8-6-7-11-15(12,2)17-14(16)13-9-4-3-5-10-13/h3-5,9-10,12H,6-8,11H2,1-2H3.
What are the key properties of (1,2-dimethylcyclohexyl) benzoate?
(1,2-dimethylcyclohexyl) benzoate has a molecular weight of 232.32 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethylcyclohexyl) benzoate is sourced from PubChem (CID 67593313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).