C23H22FN3O3 — CID 67593388
4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]isoindole-1,3-dione (PubChem CID 67593388) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is 4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67593388 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(CCCN3CCC(c4noc5cc(F)ccc45)CC3)cccc21 |
| InChI | InChI=1S/C23H22FN3O3/c24-16-6-7-17-19(13-16)30-26-21(17)15-8-11-27(12-9-15)10-2-4-14-3-1-5-18-20(14)23(29)25-22(18)28/h1,3,5-7,13,15H,2,4,8-12H2,(H,25,28,29) |
| InChIKey | HNBCTBKCJGQKRD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|