C14H20N2 — CID 67593424
3-cycloocta-1,3-dien-1-yl-4,5,6,7-tetrahydrodiazocine (PubChem CID 67593424) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-cycloocta-1,3-dien-1-yl-4,5,6,7-tetrahydrodiazocine.
| Compound Name | 3-cycloocta-1,3-dien-1-yl-4,5,6,7-tetrahydrodiazocine |
|---|---|
| PubChem CID | 67593424 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-cycloocta-1,3-dien-1-yl-4,5,6,7-tetrahydrodiazocine |
| SMILES | C1=CCCCCC(C2=NN=CCCCC2)=C1 |
| InChI | InChI=1S/C14H20N2/c1-2-5-9-13(10-6-3-1)14-11-7-4-8-12-15-16-14/h2,5,9,12H,1,3-4,6-8,10-11H2 |
| InChIKey | HXXQCMWWSSSFRH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |