About 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol
2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol (PubChem CID 67593506) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol |
| PubChem CID | 67593506 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol |
| SMILES | CCOC1(NCCO)C=CC=CC1 |
| InChI | InChI=1S/C10H17NO2/c1-2-13-10(11-8-9-12)6-4-3-5-7-10/h3-6,11-12H,2,7-9H2,1H3 |
| InChIKey | HIVHKPBFJKBUHX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol?
The IUPAC name of 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol (CID 67593506) is 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol.
What is the SMILES notation for 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol?
The canonical SMILES for 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol is CCOC1(NCCO)C=CC=CC1.
What is the InChIKey of 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol?
The InChIKey is HIVHKPBFJKBUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-2-13-10(11-8-9-12)6-4-3-5-7-10/h3-6,11-12H,2,7-9H2,1H3.
What are the key properties of 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol?
2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol has a molecular weight of 183.25 g/mol, XLogP of 0.82, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-ethoxycyclohexa-2,4-dien-1-yl)amino]ethanol is sourced from PubChem (CID 67593506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).