About 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one
7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one (PubChem CID 67593801) has the molecular formula C12H9F3O3S
and a molecular weight of 290.26 g/mol. Its IUPAC name is 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one.
Molecular Properties
| Compound Name | 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one |
| PubChem CID | 67593801 |
| Molecular Formula | C12H9F3O3S |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one |
| SMILES | COc1ccc2c(c1)CSC(C(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C12H9F3O3S/c1-18-7-2-3-8-6(4-7)5-19-10(9(8)16)11(17)12(13,14)15/h2-4,10H,5H2,1H3 |
| InChIKey | MGZHDVMQAIMHTF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one?
The IUPAC name of 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one (CID 67593801) is 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one.
What is the SMILES notation for 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one?
The canonical SMILES for 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one is COc1ccc2c(c1)CSC(C(=O)C(F)(F)F)C2=O.
What is the InChIKey of 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one?
The InChIKey is MGZHDVMQAIMHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3O3S/c1-18-7-2-3-8-6(4-7)5-19-10(9(8)16)11(17)12(13,14)15/h2-4,10H,5H2,1H3.
What are the key properties of 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one?
7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one has a molecular weight of 290.26 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3-(2,2,2-trifluoroacetyl)-1H-isothiochromen-4-one is sourced from PubChem (CID 67593801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).