C33H30N4S — CID 67594020
5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 67594020) has the molecular formula C33H30N4S and a molecular weight of 514.70 g/mol. Its IUPAC name is 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 67594020 |
| Molecular Formula | C33H30N4S |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCCCSc1cnc2[nH]cc(-c3cnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3)c2c1 |
| InChI | InChI=1S/C33H30N4S/c1-2-3-19-38-29-20-30-31(23-35-32(30)34-22-29)25-21-36-37(24-25)33(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-18,20-24H,2-3,19H2,1H3,(H,34,35) |
| InChIKey | RBSPJQCFKAWORP-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|