About 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine
5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 67594020) has the molecular formula C33H30N4S
and a molecular weight of 514.70 g/mol. Its IUPAC name is 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 67594020 |
| Molecular Formula | C33H30N4S |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCCCSc1cnc2[nH]cc(-c3cnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3)c2c1 |
| InChI | InChI=1S/C33H30N4S/c1-2-3-19-38-29-20-30-31(23-35-32(30)34-22-29)25-21-36-37(24-25)33(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-18,20-24H,2-3,19H2,1H3,(H,34,35) |
| InChIKey | RBSPJQCFKAWORP-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine (CID 67594020) is 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine is CCCCSc1cnc2[nH]cc(-c3cnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3)c2c1.
What is the InChIKey of 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is RBSPJQCFKAWORP-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H30N4S/c1-2-3-19-38-29-20-30-31(23-35-32(30)34-22-29)25-21-36-37(24-25)33(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-18,20-24H,2-3,19H2,1H3,(H,34,35).
What are the key properties of 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine?
5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 514.70 g/mol, XLogP of 8.16, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylsulfanyl-3-(1-tritylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 67594020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).