About bromomethane;9H-carbazole
bromomethane;9H-carbazole (PubChem CID 67594562) has the molecular formula C13H12BrN
and a molecular weight of 262.15 g/mol. Its IUPAC name is bromomethane;9H-carbazole.
Molecular Properties
| Compound Name | bromomethane;9H-carbazole |
| PubChem CID | 67594562 |
| Molecular Formula | C13H12BrN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | bromomethane;9H-carbazole |
| SMILES | CBr.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.CH3Br/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2/h1-8,13H;1H3 |
| InChIKey | SQUJQFLKGRGUDK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;9H-carbazole?
The IUPAC name of bromomethane;9H-carbazole (CID 67594562) is bromomethane;9H-carbazole.
What is the SMILES notation for bromomethane;9H-carbazole?
The canonical SMILES for bromomethane;9H-carbazole is CBr.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of bromomethane;9H-carbazole?
The InChIKey is SQUJQFLKGRGUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.CH3Br/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2/h1-8,13H;1H3.
What are the key properties of bromomethane;9H-carbazole?
bromomethane;9H-carbazole has a molecular weight of 262.15 g/mol, XLogP of 4.33, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;9H-carbazole is sourced from PubChem (CID 67594562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).