About 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one
6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 67594858) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one |
| PubChem CID | 67594858 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)oc2cc(N)cnc21 |
| InChI | InChI=1S/C7H7N3O2/c1-10-6-5(12-7(10)11)2-4(8)3-9-6/h2-3H,8H2,1H3 |
| InChIKey | XYFPSOITVHSSNU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one?
The IUPAC name of 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one (CID 67594858) is 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one.
What is the SMILES notation for 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one?
The canonical SMILES for 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one is Cn1c(=O)oc2cc(N)cnc21.
What is the InChIKey of 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one?
The InChIKey is XYFPSOITVHSSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-10-6-5(12-7(10)11)2-4(8)3-9-6/h2-3H,8H2,1H3.
What are the key properties of 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one?
6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one has a molecular weight of 165.15 g/mol, XLogP of 0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-methyl-[1,3]oxazolo[4,5-b]pyridin-2-one is sourced from PubChem (CID 67594858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).