About [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate
[3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate (PubChem CID 67595103) has the molecular formula C18H14Cl2N2O5S
and a molecular weight of 441.29 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate.
Molecular Properties
| Compound Name | [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate |
| PubChem CID | 67595103 |
| Molecular Formula | C18H14Cl2N2O5S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate |
| SMILES | CCC(=O)Oc1onc(-c2ccc(Cl)c(Cl)c2)c1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O5S/c1-2-15(23)26-18-16(10-3-6-12(7-4-10)28(21,24)25)17(22-27-18)11-5-8-13(19)14(20)9-11/h3-9H,2H2,1H3,(H2,21,24,25) |
| InChIKey | DPXBCDQGAYMYEX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate?
The IUPAC name of [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate (CID 67595103) is [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate.
What is the SMILES notation for [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate?
The canonical SMILES for [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate is CCC(=O)Oc1onc(-c2ccc(Cl)c(Cl)c2)c1-c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate?
The InChIKey is DPXBCDQGAYMYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2N2O5S/c1-2-15(23)26-18-16(10-3-6-12(7-4-10)28(21,24)25)17(22-27-18)11-5-8-13(19)14(20)9-11/h3-9H,2H2,1H3,(H2,21,24,25).
What are the key properties of [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate?
[3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate has a molecular weight of 441.29 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-dichlorophenyl)-4-(4-sulfamoylphenyl)-1,2-oxazol-5-yl] propanoate is sourced from PubChem (CID 67595103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).