About tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate
tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate (PubChem CID 67595333) has the molecular formula C26H25FN4O2
and a molecular weight of 444.51 g/mol. Its IUPAC name is tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate |
| PubChem CID | 67595333 |
| Molecular Formula | C26H25FN4O2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1nc2ccc(F)cc2c(-c2ccccn2)c1-c1ccccn1 |
| InChI | InChI=1S/C26H25FN4O2/c1-16(30-25(32)33-26(2,3)4)24-23(21-10-6-8-14-29-21)22(20-9-5-7-13-28-20)18-15-17(27)11-12-19(18)31-24/h5-16H,1-4H3,(H,30,32) |
| InChIKey | ZAICSAXRQJQEOY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate?
The IUPAC name of tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate (CID 67595333) is tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate?
The canonical SMILES for tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate is CC(NC(=O)OC(C)(C)C)c1nc2ccc(F)cc2c(-c2ccccn2)c1-c1ccccn1.
What is the InChIKey of tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate?
The InChIKey is ZAICSAXRQJQEOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25FN4O2/c1-16(30-25(32)33-26(2,3)4)24-23(21-10-6-8-14-29-21)22(20-9-5-7-13-28-20)18-15-17(27)11-12-19(18)31-24/h5-16H,1-4H3,(H,30,32).
What are the key properties of tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate?
tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate has a molecular weight of 444.51 g/mol, XLogP of 6.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(6-fluoro-3,4-dipyridin-2-ylquinolin-2-yl)ethyl]carbamate is sourced from PubChem (CID 67595333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).