About 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride
3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride (PubChem CID 67595683) has the molecular formula C18H20Cl2N2O3
and a molecular weight of 383.28 g/mol. Its IUPAC name is 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride |
| PubChem CID | 67595683 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)N(Cc1ccccc1Cl)C(=O)C(N)C2.Cl |
| InChI | InChI=1S/C18H19ClN2O3.ClH/c1-23-16-8-12-7-14(20)18(22)21(15(12)9-17(16)24-2)10-11-5-3-4-6-13(11)19;/h3-6,8-9,14H,7,10,20H2,1-2H3;1H |
| InChIKey | XDLBYUGLJCWART-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride?
The IUPAC name of 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride (CID 67595683) is 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride.
What is the SMILES notation for 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride?
The canonical SMILES for 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride is COc1cc2c(cc1OC)N(Cc1ccccc1Cl)C(=O)C(N)C2.Cl.
What is the InChIKey of 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride?
The InChIKey is XDLBYUGLJCWART-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O3.ClH/c1-23-16-8-12-7-14(20)18(22)21(15(12)9-17(16)24-2)10-11-5-3-4-6-13(11)19;/h3-6,8-9,14H,7,10,20H2,1-2H3;1H.
What are the key properties of 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride?
3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride has a molecular weight of 383.28 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[(2-chlorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroquinolin-2-one;hydrochloride is sourced from PubChem (CID 67595683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).