About [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate
[(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate (PubChem CID 67595914) has the molecular formula C18H16N2O5S
and a molecular weight of 372.40 g/mol. Its IUPAC name is [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate.
Molecular Properties
| Compound Name | [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate |
| PubChem CID | 67595914 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate |
| SMILES | CC(=O)OC(c1ccc(S(N)(=O)=O)cc1)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C18H16N2O5S/c1-12(21)24-18(14-7-9-15(10-8-14)26(19,22)23)17-11-16(20-25-17)13-5-3-2-4-6-13/h2-11,18H,1H3,(H2,19,22,23) |
| InChIKey | ZSAJRYSGZXONRC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate?
The IUPAC name of [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate (CID 67595914) is [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate.
What is the SMILES notation for [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate?
The canonical SMILES for [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate is CC(=O)OC(c1ccc(S(N)(=O)=O)cc1)c1cc(-c2ccccc2)no1.
What is the InChIKey of [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate?
The InChIKey is ZSAJRYSGZXONRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5S/c1-12(21)24-18(14-7-9-15(10-8-14)26(19,22)23)17-11-16(20-25-17)13-5-3-2-4-6-13/h2-11,18H,1H3,(H2,19,22,23).
What are the key properties of [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate?
[(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate has a molecular weight of 372.40 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-phenyl-1,2-oxazol-5-yl)-(4-sulfamoylphenyl)methyl] acetate is sourced from PubChem (CID 67595914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).