About 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid
6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid (PubChem CID 67596780) has the molecular formula C24H28BrN3O5
and a molecular weight of 518.41 g/mol. Its IUPAC name is 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid.
Molecular Properties
| Compound Name | 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid |
| PubChem CID | 67596780 |
| Molecular Formula | C24H28BrN3O5 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid |
| SMILES | CNCCCCCCOc1ccc2c(-c3ccc(Br)cc3)n[nH]c2c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H24BrN3O.C4H4O4/c1-22-12-4-2-3-5-13-25-17-10-11-18-19(14-17)23-24-20(18)15-6-8-16(21)9-7-15;5-3(6)1-2-4(7)8/h6-11,14,22H,2-5,12-13H2,1H3,(H,23,24);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HVQRIYUQIDOUJZ-WLHGVMLRSA-N |
| XLogP | 4.86 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid?
The IUPAC name of 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid (CID 67596780) is 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid.
What is the SMILES notation for 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid?
The canonical SMILES for 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid is CNCCCCCCOc1ccc2c(-c3ccc(Br)cc3)n[nH]c2c1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid?
The InChIKey is HVQRIYUQIDOUJZ-WLHGVMLRSA-N. The full InChI is InChI=1S/C20H24BrN3O.C4H4O4/c1-22-12-4-2-3-5-13-25-17-10-11-18-19(14-17)23-24-20(18)15-6-8-16(21)9-7-15;5-3(6)1-2-4(7)8/h6-11,14,22H,2-5,12-13H2,1H3,(H,23,24);1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid?
6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid has a molecular weight of 518.41 g/mol, XLogP of 4.86, 11 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3-(4-bromophenyl)-1H-indazol-6-yl]oxy]-N-methylhexan-1-amine;(E)-but-2-enedioic acid is sourced from PubChem (CID 67596780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).