C22H25NO7S — CID 67597202
(1S)-2-amino-1-phenylpropane-1,3-diol;(6S,8S)-8-methyl-9-oxo-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxylic acid (PubChem CID 67597202) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is (1S)-2-amino-1-phenylpropane-1,3-diol;(6S,8S)-8-methyl-9-oxo-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxylic acid.
| Compound Name | (1S)-2-amino-1-phenylpropane-1,3-diol;(6S,8S)-8-methyl-9-oxo-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 67597202 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (1S)-2-amino-1-phenylpropane-1,3-diol;(6S,8S)-8-methyl-9-oxo-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxylic acid |
| SMILES | C[C@@H]1S[C@H](C(=O)O)Cc2cc3c(cc2C1=O)OCO3.NC(CO)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H12O5S.C9H13NO2/c1-6-12(14)8-4-10-9(17-5-18-10)2-7(8)3-11(19-6)13(15)16;10-8(6-11)9(12)7-4-2-1-3-5-7/h2,4,6,11H,3,5H2,1H3,(H,15,16);1-5,8-9,11-12H,6,10H2/t6-,11-;8?,9-/m00/s1 |
| InChIKey | AZVRBHVTMZPIMB-BRLYIVJZSA-N |
| XLogP | 1.77 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |