C27H38N2O6S — CID 67597292
1-(1,2-benzothiazol-3-yl)-4-methyl-1-[6-[methyl(prop-2-enyl)amino]hexoxy]pent-3-en-2-ol;(E)-but-2-enedioic acid (PubChem CID 67597292) has the molecular formula C27H38N2O6S and a molecular weight of 518.68 g/mol. Its IUPAC name is 1-(1,2-benzothiazol-3-yl)-4-methyl-1-[6-[methyl(prop-2-enyl)amino]hexoxy]pent-3-en-2-ol;(E)-but-2-enedioic acid.
| Compound Name | 1-(1,2-benzothiazol-3-yl)-4-methyl-1-[6-[methyl(prop-2-enyl)amino]hexoxy]pent-3-en-2-ol;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 67597292 |
| Molecular Formula | C27H38N2O6S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 1-(1,2-benzothiazol-3-yl)-4-methyl-1-[6-[methyl(prop-2-enyl)amino]hexoxy]pent-3-en-2-ol;(E)-but-2-enedioic acid |
| SMILES | C=CCN(C)CCCCCCOC(c1nsc2ccccc12)C(O)C=C(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H34N2O2S.C4H4O4/c1-5-14-25(4)15-10-6-7-11-16-27-23(20(26)17-18(2)3)22-19-12-8-9-13-21(19)28-24-22;5-3(6)1-2-4(7)8/h5,8-9,12-13,17,20,23,26H,1,6-7,10-11,14-16H2,2-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | YYIIYGRAGLAHNZ-WLHGVMLRSA-N |
| XLogP | 5.07 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|