About 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine
2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine (PubChem CID 67598333) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine |
| PubChem CID | 67598333 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1=NCC=CN1 |
| InChI | InChI=1S/C8H15N3/c1-11(2)7-4-8-9-5-3-6-10-8/h3,5H,4,6-7H2,1-2H3,(H,9,10) |
| InChIKey | GQFNLPFCQFGPCE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine (CID 67598333) is 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine is CN(C)CCC1=NCC=CN1.
What is the InChIKey of 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine?
The InChIKey is GQFNLPFCQFGPCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-11(2)7-4-8-9-5-3-6-10-8/h3,5H,4,6-7H2,1-2H3,(H,9,10).
What are the key properties of 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine?
2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine has a molecular weight of 153.23 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dihydropyrimidin-2-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 67598333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).