About 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride
11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride (PubChem CID 67598449) has the molecular formula C16H12Cl2FN2+
and a molecular weight of 322.19 g/mol. Its IUPAC name is 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride.
Molecular Properties
| Compound Name | 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride |
| PubChem CID | 67598449 |
| Molecular Formula | C16H12Cl2FN2+ |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride |
| SMILES | C[n+]1c2ccccc2c(Cl)c2[nH]c3cccc(F)c3c21.Cl |
| InChI | InChI=1S/C16H10ClFN2.ClH/c1-20-12-8-3-2-5-9(12)14(17)15-16(20)13-10(18)6-4-7-11(13)19-15;/h2-8H,1H3;1H/p+1 |
| InChIKey | CWHAQVYRIAXUEU-UHFFFAOYSA-O |
| XLogP | 4.51 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride?
The IUPAC name of 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride (CID 67598449) is 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride.
What is the SMILES notation for 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride?
The canonical SMILES for 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride is C[n+]1c2ccccc2c(Cl)c2[nH]c3cccc(F)c3c21.Cl.
What is the InChIKey of 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride?
The InChIKey is CWHAQVYRIAXUEU-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H10ClFN2.ClH/c1-20-12-8-3-2-5-9(12)14(17)15-16(20)13-10(18)6-4-7-11(13)19-15;/h2-8H,1H3;1H/p+1.
What are the key properties of 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride?
11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride has a molecular weight of 322.19 g/mol, XLogP of 4.51, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-chloro-6-fluoro-5-methyl-10H-indolo[3,2-b]quinolin-5-ium;hydrochloride is sourced from PubChem (CID 67598449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).