About (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine
(E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine (PubChem CID 67598617) has the molecular formula C21H21BrN2O2
and a molecular weight of 413.32 g/mol. Its IUPAC name is (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine |
| PubChem CID | 67598617 |
| Molecular Formula | C21H21BrN2O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine |
| SMILES | C=CCN(C)C/C=C/COc1ccc(-c2noc3cc(Br)ccc23)cc1 |
| InChI | InChI=1S/C21H21BrN2O2/c1-3-12-24(2)13-4-5-14-25-18-9-6-16(7-10-18)21-19-11-8-17(22)15-20(19)26-23-21/h3-11,15H,1,12-14H2,2H3/b5-4+ |
| InChIKey | OERYYCAUHXEWAQ-SNAWJCMRSA-N |
| XLogP | 5.31 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine?
The IUPAC name of (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine (CID 67598617) is (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine.
What is the SMILES notation for (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine?
The canonical SMILES for (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine is C=CCN(C)C/C=C/COc1ccc(-c2noc3cc(Br)ccc23)cc1.
What is the InChIKey of (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine?
The InChIKey is OERYYCAUHXEWAQ-SNAWJCMRSA-N. The full InChI is InChI=1S/C21H21BrN2O2/c1-3-12-24(2)13-4-5-14-25-18-9-6-16(7-10-18)21-19-11-8-17(22)15-20(19)26-23-21/h3-11,15H,1,12-14H2,2H3/b5-4+.
What are the key properties of (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine?
(E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine has a molecular weight of 413.32 g/mol, XLogP of 5.31, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[4-(6-bromo-1,2-benzoxazol-3-yl)phenoxy]-N-methyl-N-prop-2-enylbut-2-en-1-amine is sourced from PubChem (CID 67598617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).