About 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine
5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine (PubChem CID 67598676) has the molecular formula C13H22FN
and a molecular weight of 211.32 g/mol. Its IUPAC name is 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 67598676 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine |
| SMILES | CCCCC(CC)C1(N)C=CC=C(F)C1 |
| InChI | InChI=1S/C13H22FN/c1-3-5-7-11(4-2)13(15)9-6-8-12(14)10-13/h6,8-9,11H,3-5,7,10,15H2,1-2H3 |
| InChIKey | UPEORKDJEDBCOB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine (CID 67598676) is 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine is CCCCC(CC)C1(N)C=CC=C(F)C1.
What is the InChIKey of 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine?
The InChIKey is UPEORKDJEDBCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22FN/c1-3-5-7-11(4-2)13(15)9-6-8-12(14)10-13/h6,8-9,11H,3-5,7,10,15H2,1-2H3.
What are the key properties of 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine?
5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine has a molecular weight of 211.32 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-heptan-3-ylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 67598676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).