About 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride
2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride (PubChem CID 67598783) has the molecular formula C18H28Cl2N4O4
and a molecular weight of 435.35 g/mol. Its IUPAC name is 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride |
| PubChem CID | 67598783 |
| Molecular Formula | C18H28Cl2N4O4 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(Oc1ccccc1)(C(=O)O)C(=O)N1CCN(C2CCNCC2)CC1 |
| InChI | InChI=1S/C18H26N4O4.2ClH/c19-18(17(24)25,26-15-4-2-1-3-5-15)16(23)22-12-10-21(11-13-22)14-6-8-20-9-7-14;;/h1-5,14,20H,6-13,19H2,(H,24,25);2*1H |
| InChIKey | LOOILOBNRDVYRP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride?
The IUPAC name of 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride (CID 67598783) is 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride.
What is the SMILES notation for 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride?
The canonical SMILES for 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride is Cl.Cl.NC(Oc1ccccc1)(C(=O)O)C(=O)N1CCN(C2CCNCC2)CC1.
What is the InChIKey of 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride?
The InChIKey is LOOILOBNRDVYRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O4.2ClH/c19-18(17(24)25,26-15-4-2-1-3-5-15)16(23)22-12-10-21(11-13-22)14-6-8-20-9-7-14;;/h1-5,14,20H,6-13,19H2,(H,24,25);2*1H.
What are the key properties of 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride?
2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride has a molecular weight of 435.35 g/mol, XLogP of 0.54, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-oxo-2-phenoxy-3-(4-piperidin-4-ylpiperazin-1-yl)propanoic acid;dihydrochloride is sourced from PubChem (CID 67598783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).