C15H24O — CID 67599201
2-methyl-2,3,3a,4,5,6,7,8,9,10-decahydrocyclododeca[b]furan (PubChem CID 67599201) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-methyl-2,3,3a,4,5,6,7,8,9,10-decahydrocyclododeca[b]furan.
| Compound Name | 2-methyl-2,3,3a,4,5,6,7,8,9,10-decahydrocyclododeca[b]furan |
|---|---|
| PubChem CID | 67599201 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-methyl-2,3,3a,4,5,6,7,8,9,10-decahydrocyclododeca[b]furan |
| SMILES | CC1CC2CCCCCCCC=CC=C2O1 |
| InChI | InChI=1S/C15H24O/c1-13-12-14-10-8-6-4-2-3-5-7-9-11-15(14)16-13/h7,9,11,13-14H,2-6,8,10,12H2,1H3 |
| InChIKey | JJGXAIKDZYAUKH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |