About 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline
1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline (PubChem CID 67599248) has the molecular formula C20H18ClNO3
and a molecular weight of 355.82 g/mol. Its IUPAC name is 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline.
Molecular Properties
| Compound Name | 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline |
| PubChem CID | 67599248 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline |
| SMILES | COc1cc2ccnc(/C=C/c3ccccc3Cl)c2c(OC)c1OC |
| InChI | InChI=1S/C20H18ClNO3/c1-23-17-12-14-10-11-22-16(18(14)20(25-3)19(17)24-2)9-8-13-6-4-5-7-15(13)21/h4-12H,1-3H3/b9-8+ |
| InChIKey | MVBRFSKHJZPSNB-CMDGGOBGSA-N |
| XLogP | 5.08 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline?
The IUPAC name of 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline (CID 67599248) is 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline.
What is the SMILES notation for 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline?
The canonical SMILES for 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline is COc1cc2ccnc(/C=C/c3ccccc3Cl)c2c(OC)c1OC.
What is the InChIKey of 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline?
The InChIKey is MVBRFSKHJZPSNB-CMDGGOBGSA-N. The full InChI is InChI=1S/C20H18ClNO3/c1-23-17-12-14-10-11-22-16(18(14)20(25-3)19(17)24-2)9-8-13-6-4-5-7-15(13)21/h4-12H,1-3H3/b9-8+.
What are the key properties of 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline?
1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline has a molecular weight of 355.82 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline is sourced from PubChem (CID 67599248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).