C20H18ClNO3 — CID 67599248
1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline (PubChem CID 67599248) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline.
| Compound Name | 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline |
|---|---|
| PubChem CID | 67599248 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-[(E)-2-(2-chlorophenyl)ethenyl]-6,7,8-trimethoxyisoquinoline |
| SMILES | COc1cc2ccnc(/C=C/c3ccccc3Cl)c2c(OC)c1OC |
| InChI | InChI=1S/C20H18ClNO3/c1-23-17-12-14-10-11-22-16(18(14)20(25-3)19(17)24-2)9-8-13-6-4-5-7-15(13)21/h4-12H,1-3H3/b9-8+ |
| InChIKey | MVBRFSKHJZPSNB-CMDGGOBGSA-N |
| XLogP | 5.08 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |