About 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride
4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride (PubChem CID 67599584) has the molecular formula C17H15ClN2O
and a molecular weight of 298.77 g/mol. Its IUPAC name is 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride.
Molecular Properties
| Compound Name | 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride |
| PubChem CID | 67599584 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride |
| SMILES | COc1cccc2cc3nc4ccccc4c-3n(C)c12.Cl |
| InChI | InChI=1S/C17H14N2O.ClH/c1-19-16-11(6-5-9-15(16)20-2)10-14-17(19)12-7-3-4-8-13(12)18-14;/h3-10H,1-2H3;1H |
| InChIKey | BAXVFFJKFISROU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride?
The IUPAC name of 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride (CID 67599584) is 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride.
What is the SMILES notation for 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride?
The canonical SMILES for 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride is COc1cccc2cc3nc4ccccc4c-3n(C)c12.Cl.
What is the InChIKey of 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride?
The InChIKey is BAXVFFJKFISROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O.ClH/c1-19-16-11(6-5-9-15(16)20-2)10-14-17(19)12-7-3-4-8-13(12)18-14;/h3-10H,1-2H3;1H.
What are the key properties of 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride?
4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride has a molecular weight of 298.77 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5-methylindolo[3,2-b]quinoline;hydrochloride is sourced from PubChem (CID 67599584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).