About 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol
4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol (PubChem CID 67599813) has the molecular formula C22H22FN3O
and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol |
| PubChem CID | 67599813 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol |
| SMILES | CN1C(c2ccccc2)NC(C)(c2ccncc2)C1(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O/c1-21(17-12-14-24-15-13-17)22(27,18-8-10-19(23)11-9-18)26(2)20(25-21)16-6-4-3-5-7-16/h3-15,20,25,27H,1-2H3 |
| InChIKey | JNWBNBCCHQPFHY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol?
The IUPAC name of 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol (CID 67599813) is 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol.
What is the SMILES notation for 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol?
The canonical SMILES for 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol is CN1C(c2ccccc2)NC(C)(c2ccncc2)C1(O)c1ccc(F)cc1.
What is the InChIKey of 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol?
The InChIKey is JNWBNBCCHQPFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FN3O/c1-21(17-12-14-24-15-13-17)22(27,18-8-10-19(23)11-9-18)26(2)20(25-21)16-6-4-3-5-7-16/h3-15,20,25,27H,1-2H3.
What are the key properties of 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol?
4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol has a molecular weight of 363.44 g/mol, XLogP of 3.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-3,5-dimethyl-2-phenyl-5-pyridin-4-ylimidazolidin-4-ol is sourced from PubChem (CID 67599813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).