C16H32N2 — CID 67600451
1-azabicyclo[2.2.2]octane;2,2,6,6-tetramethylpiperidine (PubChem CID 67600451) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-azabicyclo[2.2.2]octane;2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 67600451 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;2,2,6,6-tetramethylpiperidine |
| SMILES | C1CN2CCC1CC2.CC1(C)CCCC(C)(C)N1 |
| InChI | InChI=1S/C9H19N.C7H13N/c1-8(2)6-5-7-9(3,4)10-8;1-4-8-5-2-7(1)3-6-8/h10H,5-7H2,1-4H3;7H,1-6H2 |
| InChIKey | JWCDMJUHNUGZOQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |