C46H78O8 — CID 67600668
5-(2-ethoxy-2-methoxyethoxy)carbonyl-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid (PubChem CID 67600668) has the molecular formula C46H78O8 and a molecular weight of 759.12 g/mol. Its IUPAC name is 5-(2-ethoxy-2-methoxyethoxy)carbonyl-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid.
| Compound Name | 5-(2-ethoxy-2-methoxyethoxy)carbonyl-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67600668 |
| Molecular Formula | C46H78O8 |
| Molecular Weight | 759.12 g/mol |
| Exact Mass | 758.57 |
| IUPAC Name | 5-(2-ethoxy-2-methoxyethoxy)carbonyl-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid |
| SMILES | C=C(CC=C(C)C(=O)O)C(=O)OCC(OC)OCC.O=C(O)C(=C(C1CCCCCCCCC1)C1CCCCCCCCC1)C1CCCCCCCCC1 |
| InChI | InChI=1S/C33H58O2.C13H20O6/c34-33(35)32(30-26-20-14-8-3-9-15-21-27-30)31(28-22-16-10-4-1-5-11-17-23-28)29-24-18-12-6-2-7-13-19-25-29;1-5-18-11(17-4)8-19-13(16)10(3)7-6-9(2)12(14)15/h28-30H,1-27H2,(H,34,35);6,11H,3,5,7-8H2,1-2,4H3,(H,14,15) |
| InChIKey | HPWZPWWNIXXXNP-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.12 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|