About 5,6-dimethoxy-3H-indol-2-amine;hydrochloride
5,6-dimethoxy-3H-indol-2-amine;hydrochloride (PubChem CID 67601231) has the molecular formula C10H13ClN2O2
and a molecular weight of 228.68 g/mol. Its IUPAC name is 5,6-dimethoxy-3H-indol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5,6-dimethoxy-3H-indol-2-amine;hydrochloride |
| PubChem CID | 67601231 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 5,6-dimethoxy-3H-indol-2-amine;hydrochloride |
| SMILES | COc1cc2c(cc1OC)N=C(N)C2.Cl |
| InChI | InChI=1S/C10H12N2O2.ClH/c1-13-8-3-6-4-10(11)12-7(6)5-9(8)14-2;/h3,5H,4H2,1-2H3,(H2,11,12);1H |
| InChIKey | BPCOZNMTPXTNQP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethoxy-3H-indol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-3H-indol-2-amine;hydrochloride?
The IUPAC name of 5,6-dimethoxy-3H-indol-2-amine;hydrochloride (CID 67601231) is 5,6-dimethoxy-3H-indol-2-amine;hydrochloride.
What is the SMILES notation for 5,6-dimethoxy-3H-indol-2-amine;hydrochloride?
The canonical SMILES for 5,6-dimethoxy-3H-indol-2-amine;hydrochloride is COc1cc2c(cc1OC)N=C(N)C2.Cl.
What is the InChIKey of 5,6-dimethoxy-3H-indol-2-amine;hydrochloride?
The InChIKey is BPCOZNMTPXTNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2.ClH/c1-13-8-3-6-4-10(11)12-7(6)5-9(8)14-2;/h3,5H,4H2,1-2H3,(H2,11,12);1H.
What are the key properties of 5,6-dimethoxy-3H-indol-2-amine;hydrochloride?
5,6-dimethoxy-3H-indol-2-amine;hydrochloride has a molecular weight of 228.68 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-3H-indol-2-amine;hydrochloride is sourced from PubChem (CID 67601231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).