C47H80O8 — CID 67601254
5-(2,2-diethoxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid (PubChem CID 67601254) has the molecular formula C47H80O8 and a molecular weight of 773.15 g/mol. Its IUPAC name is 5-(2,2-diethoxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid.
| Compound Name | 5-(2,2-diethoxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67601254 |
| Molecular Formula | C47H80O8 |
| Molecular Weight | 773.15 g/mol |
| Exact Mass | 772.59 |
| IUPAC Name | 5-(2,2-diethoxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid |
| SMILES | C=C(CC=C(C)C(=O)O)C(=O)OCC(OCC)OCC.O=C(O)C(=C(C1CCCCCCCCC1)C1CCCCCCCCC1)C1CCCCCCCCC1 |
| InChI | InChI=1S/C33H58O2.C14H22O6/c34-33(35)32(30-26-20-14-8-3-9-15-21-27-30)31(28-22-16-10-4-1-5-11-17-23-28)29-24-18-12-6-2-7-13-19-25-29;1-5-18-12(19-6-2)9-20-14(17)11(4)8-7-10(3)13(15)16/h28-30H,1-27H2,(H,34,35);7,12H,4-6,8-9H2,1-3H3,(H,15,16) |
| InChIKey | GWPLEXSDMZRDIM-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.15 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|