About 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol
1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol (PubChem CID 67602021) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol.
Molecular Properties
| Compound Name | 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol |
| PubChem CID | 67602021 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol |
| SMILES | Oc1c(CC(O)C(O)Cc2ccccc2)ccc2c1CCN2 |
| InChI | InChI=1S/C18H21NO3/c20-16(10-12-4-2-1-3-5-12)17(21)11-13-6-7-15-14(18(13)22)8-9-19-15/h1-7,16-17,19-22H,8-11H2 |
| InChIKey | WYQLRIRHPDRSNI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol?
The IUPAC name of 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol (CID 67602021) is 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol.
What is the SMILES notation for 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol?
The canonical SMILES for 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol is Oc1c(CC(O)C(O)Cc2ccccc2)ccc2c1CCN2.
What is the InChIKey of 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol?
The InChIKey is WYQLRIRHPDRSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO3/c20-16(10-12-4-2-1-3-5-12)17(21)11-13-6-7-15-14(18(13)22)8-9-19-15/h1-7,16-17,19-22H,8-11H2.
What are the key properties of 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol?
1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol has a molecular weight of 299.37 g/mol, XLogP of 1.87, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxy-2,3-dihydro-1H-indol-5-yl)-4-phenylbutane-2,3-diol is sourced from PubChem (CID 67602021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).