C24H24F2N4O3 — CID 67602329
3-[3,5-difluoro-5-[3-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]propanoic acid (PubChem CID 67602329) has the molecular formula C24H24F2N4O3 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-[3,5-difluoro-5-[3-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]propanoic acid.
| Compound Name | 3-[3,5-difluoro-5-[3-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]propanoic acid |
|---|---|
| PubChem CID | 67602329 |
| Molecular Formula | C24H24F2N4O3 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 3-[3,5-difluoro-5-[3-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]propanoic acid |
| SMILES | NN/C=N/c1cccc(C(=O)NCc2cccc(C3(F)C=C(F)C=C(CCC(=O)O)C3)c2)c1 |
| InChI | InChI=1S/C24H24F2N4O3/c25-20-10-16(7-8-22(31)32)12-24(26,13-20)19-5-1-3-17(9-19)14-28-23(33)18-4-2-6-21(11-18)29-15-30-27/h1-6,9-11,13,15H,7-8,12,14,27H2,(H,28,33)(H,29,30)(H,31,32) |
| InChIKey | NQAJZZIGLPEQSP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|