About N-(2-chloroethyl)acetamide;chloromethylcyclopropane
N-(2-chloroethyl)acetamide;chloromethylcyclopropane (PubChem CID 67602394) has the molecular formula C8H15Cl2NO
and a molecular weight of 212.12 g/mol. Its IUPAC name is N-(2-chloroethyl)acetamide;chloromethylcyclopropane.
Molecular Properties
| Compound Name | N-(2-chloroethyl)acetamide;chloromethylcyclopropane |
| PubChem CID | 67602394 |
| Molecular Formula | C8H15Cl2NO |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | N-(2-chloroethyl)acetamide;chloromethylcyclopropane |
| SMILES | CC(=O)NCCCl.ClCC1CC1 |
| InChI | InChI=1S/C4H8ClNO.C4H7Cl/c1-4(7)6-3-2-5;5-3-4-1-2-4/h2-3H2,1H3,(H,6,7);4H,1-3H2 |
| InChIKey | HBRDHIJIBMNDIG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)acetamide;chloromethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)acetamide;chloromethylcyclopropane?
The IUPAC name of N-(2-chloroethyl)acetamide;chloromethylcyclopropane (CID 67602394) is N-(2-chloroethyl)acetamide;chloromethylcyclopropane.
What is the SMILES notation for N-(2-chloroethyl)acetamide;chloromethylcyclopropane?
The canonical SMILES for N-(2-chloroethyl)acetamide;chloromethylcyclopropane is CC(=O)NCCCl.ClCC1CC1.
What is the InChIKey of N-(2-chloroethyl)acetamide;chloromethylcyclopropane?
The InChIKey is HBRDHIJIBMNDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO.C4H7Cl/c1-4(7)6-3-2-5;5-3-4-1-2-4/h2-3H2,1H3,(H,6,7);4H,1-3H2.
What are the key properties of N-(2-chloroethyl)acetamide;chloromethylcyclopropane?
N-(2-chloroethyl)acetamide;chloromethylcyclopropane has a molecular weight of 212.12 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)acetamide;chloromethylcyclopropane is sourced from PubChem (CID 67602394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).