About [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol
[4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol (PubChem CID 67602541) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol |
| PubChem CID | 67602541 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol |
| SMILES | CNC1=CC(CO)=CCC1OC |
| InChI | InChI=1S/C9H15NO2/c1-10-8-5-7(6-11)3-4-9(8)12-2/h3,5,9-11H,4,6H2,1-2H3 |
| InChIKey | LIUBULNOBRCWAF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol?
The IUPAC name of [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol (CID 67602541) is [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol.
What is the SMILES notation for [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol?
The canonical SMILES for [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol is CNC1=CC(CO)=CCC1OC.
What is the InChIKey of [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol?
The InChIKey is LIUBULNOBRCWAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-10-8-5-7(6-11)3-4-9(8)12-2/h3,5,9-11H,4,6H2,1-2H3.
What are the key properties of [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol?
[4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol has a molecular weight of 169.22 g/mol, XLogP of 0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-5-(methylamino)cyclohexa-1,5-dien-1-yl]methanol is sourced from PubChem (CID 67602541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).