About [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate
[4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate (PubChem CID 67602624) has the molecular formula C26H19FO3
and a molecular weight of 398.43 g/mol. Its IUPAC name is [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate.
Molecular Properties
| Compound Name | [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate |
| PubChem CID | 67602624 |
| Molecular Formula | C26H19FO3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate |
| SMILES | C=CCC(=O)Oc1ccc(Oc2c(-c3cccc(F)c3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H19FO3/c1-2-6-25(28)29-21-12-14-22(15-13-21)30-26-23-10-4-3-7-18(23)11-16-24(26)19-8-5-9-20(27)17-19/h2-5,7-17H,1,6H2 |
| InChIKey | BBCFAZQSZWLIRJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate?
The IUPAC name of [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate (CID 67602624) is [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate.
What is the SMILES notation for [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate?
The canonical SMILES for [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate is C=CCC(=O)Oc1ccc(Oc2c(-c3cccc(F)c3)ccc3ccccc23)cc1.
What is the InChIKey of [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate?
The InChIKey is BBCFAZQSZWLIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19FO3/c1-2-6-25(28)29-21-12-14-22(15-13-21)30-26-23-10-4-3-7-18(23)11-16-24(26)19-8-5-9-20(27)17-19/h2-5,7-17H,1,6H2.
What are the key properties of [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate?
[4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate has a molecular weight of 398.43 g/mol, XLogP of 6.92, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(3-fluorophenyl)naphthalen-1-yl]oxyphenyl] but-3-enoate is sourced from PubChem (CID 67602624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).