C23H38O2Si — CID 67603666
5-ethyl-1,7a-dimethyl-5-(7-trimethylsilyloxyhept-3-ynyl)-3,3a,6,7-tetrahydroinden-4-one (PubChem CID 67603666) has the molecular formula C23H38O2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is 5-ethyl-1,7a-dimethyl-5-(7-trimethylsilyloxyhept-3-ynyl)-3,3a,6,7-tetrahydroinden-4-one.
| Compound Name | 5-ethyl-1,7a-dimethyl-5-(7-trimethylsilyloxyhept-3-ynyl)-3,3a,6,7-tetrahydroinden-4-one |
|---|---|
| PubChem CID | 67603666 |
| Molecular Formula | C23H38O2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 5-ethyl-1,7a-dimethyl-5-(7-trimethylsilyloxyhept-3-ynyl)-3,3a,6,7-tetrahydroinden-4-one |
| SMILES | CCC1(CCC#CCCCO[Si](C)(C)C)CCC2(C)C(C)=CCC2C1=O |
| InChI | InChI=1S/C23H38O2Si/c1-7-23(15-11-9-8-10-12-18-25-26(4,5)6)17-16-22(3)19(2)13-14-20(22)21(23)24/h13,20H,7,10-12,14-18H2,1-6H3 |
| InChIKey | SJXUFEHVESNABB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|