About [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane
[1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane (PubChem CID 67603949) has the molecular formula C15H23NOSi
and a molecular weight of 261.44 g/mol. Its IUPAC name is [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane.
Molecular Properties
| Compound Name | [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane |
| PubChem CID | 67603949 |
| Molecular Formula | C15H23NOSi |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane |
| SMILES | CC(C)(CC1=CCCc2ncccc21)[Si](C)(C)O |
| InChI | InChI=1S/C15H23NOSi/c1-15(2,18(3,4)17)11-12-7-5-9-14-13(12)8-6-10-16-14/h6-8,10,17H,5,9,11H2,1-4H3 |
| InChIKey | WCMOLVIQJGVTOG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane?
The IUPAC name of [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane (CID 67603949) is [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane.
What is the SMILES notation for [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane?
The canonical SMILES for [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane is CC(C)(CC1=CCCc2ncccc21)[Si](C)(C)O.
What is the InChIKey of [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane?
The InChIKey is WCMOLVIQJGVTOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NOSi/c1-15(2,18(3,4)17)11-12-7-5-9-14-13(12)8-6-10-16-14/h6-8,10,17H,5,9,11H2,1-4H3.
What are the key properties of [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane?
[1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane has a molecular weight of 261.44 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(7,8-dihydroquinolin-5-yl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane is sourced from PubChem (CID 67603949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).