About 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate
4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate (PubChem CID 67604010) has the molecular formula C20H26N2O8
and a molecular weight of 422.43 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate |
| PubChem CID | 67604010 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate |
| SMILES | C=CC(=O)c1cc(OCCCOC(=O)[C@@H](N)CC(=O)OC(C)(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N2O8/c1-5-17(23)14-11-13(7-8-16(14)22(26)27)28-9-6-10-29-19(25)15(21)12-18(24)30-20(2,3)4/h5,7-8,11,15H,1,6,9-10,12,21H2,2-4H3/t15-/m0/s1 |
| InChIKey | ZRVNQOQHQJZAQU-HNNXBMFYSA-N |
| XLogP | 2.33 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate (CID 67604010) is 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate is C=CC(=O)c1cc(OCCCOC(=O)[C@@H](N)CC(=O)OC(C)(C)C)ccc1[N+](=O)[O-].
What is the InChIKey of 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate?
The InChIKey is ZRVNQOQHQJZAQU-HNNXBMFYSA-N. The full InChI is InChI=1S/C20H26N2O8/c1-5-17(23)14-11-13(7-8-16(14)22(26)27)28-9-6-10-29-19(25)15(21)12-18(24)30-20(2,3)4/h5,7-8,11,15H,1,6,9-10,12,21H2,2-4H3/t15-/m0/s1.
What are the key properties of 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate?
4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate has a molecular weight of 422.43 g/mol, XLogP of 2.33, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-[3-(4-nitro-3-prop-2-enoylphenoxy)propyl] (2S)-2-aminobutanedioate is sourced from PubChem (CID 67604010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).