C26H20ClNO5 — CID 67604226
4-[2-(4-chlorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-oxobutanoic acid (PubChem CID 67604226) has the molecular formula C26H20ClNO5 and a molecular weight of 461.90 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-oxobutanoic acid.
| Compound Name | 4-[2-(4-chlorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67604226 |
| Molecular Formula | C26H20ClNO5 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 4-[2-(4-chlorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-4-oxobutanoic acid |
| SMILES | O=C(CC(CCN1C(=O)c2ccccc2C1=O)C(=O)O)c1ccccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20ClNO5/c27-18-11-9-16(10-12-18)19-5-1-2-6-20(19)23(29)15-17(26(32)33)13-14-28-24(30)21-7-3-4-8-22(21)25(28)31/h1-12,17H,13-15H2,(H,32,33) |
| InChIKey | NCMPTVWVZFTQTB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|