C14H17NO5 — CID 67604335
1-[(3,4-dihydroxybenzoyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 67604335) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-[(3,4-dihydroxybenzoyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(3,4-dihydroxybenzoyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67604335 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-[(3,4-dihydroxybenzoyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCCCC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H17NO5/c16-10-5-4-9(8-11(10)17)12(18)15-14(13(19)20)6-2-1-3-7-14/h4-5,8,16-17H,1-3,6-7H2,(H,15,18)(H,19,20) |
| InChIKey | VENDDFYUYXNYQT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|