C16H23NO7 — CID 67604791
2-[4-nitro-3-(2,3,4-trimethoxyphenyl)butyl]-1,3-dioxolane (PubChem CID 67604791) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-[4-nitro-3-(2,3,4-trimethoxyphenyl)butyl]-1,3-dioxolane.
| Compound Name | 2-[4-nitro-3-(2,3,4-trimethoxyphenyl)butyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 67604791 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-[4-nitro-3-(2,3,4-trimethoxyphenyl)butyl]-1,3-dioxolane |
| SMILES | COc1ccc(C(CCC2OCCO2)C[N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C16H23NO7/c1-20-13-6-5-12(15(21-2)16(13)22-3)11(10-17(18)19)4-7-14-23-8-9-24-14/h5-6,11,14H,4,7-10H2,1-3H3 |
| InChIKey | WRPYTCFHJQYJAZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|