About N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide
N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide (PubChem CID 676050) has the molecular formula C13H10ClNO4S
and a molecular weight of 311.75 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide |
| PubChem CID | 676050 |
| Molecular Formula | C13H10ClNO4S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClNO4S/c14-9-1-4-11(5-2-9)20(16,17)15-10-3-6-12-13(7-10)19-8-18-12/h1-7,15H,8H2 |
| InChIKey | HHMTYHVJYUBXBA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide (CID 676050) is N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide is O=S(=O)(Nc1ccc2c(c1)OCO2)c1ccc(Cl)cc1.
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide?
The InChIKey is HHMTYHVJYUBXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO4S/c14-9-1-4-11(5-2-9)20(16,17)15-10-3-6-12-13(7-10)19-8-18-12/h1-7,15H,8H2.
What are the key properties of N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide?
N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide has a molecular weight of 311.75 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-4-chlorobenzenesulfonamide is sourced from PubChem (CID 676050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).