C33H40O7 — CID 67605355
tert-butyl 2-[(2R,3S,4R,5R,6S)-2-hydroxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate (PubChem CID 67605355) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is tert-butyl 2-[(2R,3S,4R,5R,6S)-2-hydroxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate.
| Compound Name | tert-butyl 2-[(2R,3S,4R,5R,6S)-2-hydroxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 67605355 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | tert-butyl 2-[(2R,3S,4R,5R,6S)-2-hydroxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
| SMILES | C[C@@H]1O[C@](O)(CC(=O)OC(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H40O7/c1-24-29(36-21-25-14-8-5-9-15-25)30(37-22-26-16-10-6-11-17-26)31(38-23-27-18-12-7-13-19-27)33(35,39-24)20-28(34)40-32(2,3)4/h5-19,24,29-31,35H,20-23H2,1-4H3/t24-,29+,30+,31-,33+/m0/s1 |
| InChIKey | FRTLHVQZOBMBGD-SUOPFMPTSA-N |
| XLogP | 5.58 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |